C21H38IN5O2S — CID 111937302
1-[2-(azepan-1-yl)-3-methylbutyl]-2-methyl-3-[[4-(methylsulfamoyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111937302) has the molecular formula C21H38IN5O2S and a molecular weight of 551.54 g/mol. Its IUPAC name is 1-[2-(azepan-1-yl)-3-methylbutyl]-2-methyl-3-[[4-(methylsulfamoyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(azepan-1-yl)-3-methylbutyl]-2-methyl-3-[[4-(methylsulfamoyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111937302 |
| Molecular Formula | C21H38IN5O2S |
| Molecular Weight | 551.54 g/mol |
| Exact Mass | 551.18 |
| IUPAC Name | 1-[2-(azepan-1-yl)-3-methylbutyl]-2-methyl-3-[[4-(methylsulfamoyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(S(=O)(=O)NC)cc1)NCC(C(C)C)N1CCCCCC1.I |
| InChI | InChI=1S/C21H37N5O2S.HI/c1-17(2)20(26-13-7-5-6-8-14-26)16-25-21(22-3)24-15-18-9-11-19(12-10-18)29(27,28)23-4;/h9-12,17,20,23H,5-8,13-16H2,1-4H3,(H2,22,24,25);1H |
| InChIKey | GDVAAZHAAWYBKH-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.54 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|