C21H34N4O2S — CID 111827033
cyclopentyl 4-[[N'-methyl-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]butanoate (PubChem CID 111827033) has the molecular formula C21H34N4O2S and a molecular weight of 406.60 g/mol. Its IUPAC name is cyclopentyl 4-[[N'-methyl-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]butanoate.
| Compound Name | cyclopentyl 4-[[N'-methyl-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]butanoate |
|---|---|
| PubChem CID | 111827033 |
| Molecular Formula | C21H34N4O2S |
| Molecular Weight | 406.60 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | cyclopentyl 4-[[N'-methyl-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]butanoate |
| SMILES | C/N=C(\NCCCC(=O)OC1CCCC1)NCC(c1cccs1)N1CCCC1 |
| InChI | InChI=1S/C21H34N4O2S/c1-22-21(23-12-6-11-20(26)27-17-8-2-3-9-17)24-16-18(19-10-7-15-28-19)25-13-4-5-14-25/h7,10,15,17-18H,2-6,8-9,11-14,16H2,1H3,(H2,22,23,24) |
| InChIKey | SILBFRCQSVTJTD-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.60 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|