C24H33N5O — CID 111326118
N-[3-[[N'-methyl-N-(2-phenyl-2-pyrrolidin-1-ylethyl)carbamimidoyl]amino]propyl]benzamide (PubChem CID 111326118) has the molecular formula C24H33N5O and a molecular weight of 407.56 g/mol. Its IUPAC name is N-[3-[[N'-methyl-N-(2-phenyl-2-pyrrolidin-1-ylethyl)carbamimidoyl]amino]propyl]benzamide.
| Compound Name | N-[3-[[N'-methyl-N-(2-phenyl-2-pyrrolidin-1-ylethyl)carbamimidoyl]amino]propyl]benzamide |
|---|---|
| PubChem CID | 111326118 |
| Molecular Formula | C24H33N5O |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.27 |
| IUPAC Name | N-[3-[[N'-methyl-N-(2-phenyl-2-pyrrolidin-1-ylethyl)carbamimidoyl]amino]propyl]benzamide |
| SMILES | C/N=C(\NCCCNC(=O)c1ccccc1)NCC(c1ccccc1)N1CCCC1 |
| InChI | InChI=1S/C24H33N5O/c1-25-24(27-16-10-15-26-23(30)21-13-6-3-7-14-21)28-19-22(29-17-8-9-18-29)20-11-4-2-5-12-20/h2-7,11-14,22H,8-10,15-19H2,1H3,(H,26,30)(H2,25,27,28) |
| InChIKey | NBXVTUQTJVLACD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|