C17H29N5O2S — CID 111326028
1-[2-(methanesulfonamido)ethyl]-2-methyl-3-(2-phenyl-2-pyrrolidin-1-ylethyl)guanidine (PubChem CID 111326028) has the molecular formula C17H29N5O2S and a molecular weight of 367.52 g/mol. Its IUPAC name is 1-[2-(methanesulfonamido)ethyl]-2-methyl-3-(2-phenyl-2-pyrrolidin-1-ylethyl)guanidine.
| Compound Name | 1-[2-(methanesulfonamido)ethyl]-2-methyl-3-(2-phenyl-2-pyrrolidin-1-ylethyl)guanidine |
|---|---|
| PubChem CID | 111326028 |
| Molecular Formula | C17H29N5O2S |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | 1-[2-(methanesulfonamido)ethyl]-2-methyl-3-(2-phenyl-2-pyrrolidin-1-ylethyl)guanidine |
| SMILES | C/N=C(\NCCNS(C)(=O)=O)NCC(c1ccccc1)N1CCCC1 |
| InChI | InChI=1S/C17H29N5O2S/c1-18-17(19-10-11-21-25(2,23)24)20-14-16(22-12-6-7-13-22)15-8-4-3-5-9-15/h3-5,8-9,16,21H,6-7,10-14H2,1-2H3,(H2,18,19,20) |
| InChIKey | JZCMHWJMUCRIIF-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|