C14H31N5O — CID 111383187
N-tert-butyl-2-[[N-[2-(dimethylamino)-2-methylpropyl]-N'-methylcarbamimidoyl]amino]acetamide (PubChem CID 111383187) has the molecular formula C14H31N5O and a molecular weight of 285.44 g/mol. Its IUPAC name is N-tert-butyl-2-[[N-[2-(dimethylamino)-2-methylpropyl]-N'-methylcarbamimidoyl]amino]acetamide.
| Compound Name | N-tert-butyl-2-[[N-[2-(dimethylamino)-2-methylpropyl]-N'-methylcarbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111383187 |
| Molecular Formula | C14H31N5O |
| Molecular Weight | 285.44 g/mol |
| Exact Mass | 285.25 |
| IUPAC Name | N-tert-butyl-2-[[N-[2-(dimethylamino)-2-methylpropyl]-N'-methylcarbamimidoyl]amino]acetamide |
| SMILES | C/N=C(\NCC(=O)NC(C)(C)C)NCC(C)(C)N(C)C |
| InChI | InChI=1S/C14H31N5O/c1-13(2,3)18-11(20)9-16-12(15-6)17-10-14(4,5)19(7)8/h9-10H2,1-8H3,(H,18,20)(H2,15,16,17) |
| InChIKey | DUWVPWLDROISSV-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.44 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|