C15H32N4O3S — CID 111634811
N-tert-butyl-2-[[N-(2,2-dimethyl-4-methylsulfonylbutyl)-N'-methylcarbamimidoyl]amino]acetamide (PubChem CID 111634811) has the molecular formula C15H32N4O3S and a molecular weight of 348.51 g/mol. Its IUPAC name is N-tert-butyl-2-[[N-(2,2-dimethyl-4-methylsulfonylbutyl)-N'-methylcarbamimidoyl]amino]acetamide.
| Compound Name | N-tert-butyl-2-[[N-(2,2-dimethyl-4-methylsulfonylbutyl)-N'-methylcarbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111634811 |
| Molecular Formula | C15H32N4O3S |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | N-tert-butyl-2-[[N-(2,2-dimethyl-4-methylsulfonylbutyl)-N'-methylcarbamimidoyl]amino]acetamide |
| SMILES | C/N=C(\NCC(=O)NC(C)(C)C)NCC(C)(C)CCS(C)(=O)=O |
| InChI | InChI=1S/C15H32N4O3S/c1-14(2,3)19-12(20)10-17-13(16-6)18-11-15(4,5)8-9-23(7,21)22/h8-11H2,1-7H3,(H,19,20)(H2,16,17,18) |
| InChIKey | PYDOKSZCYARHFY-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|