C17H30IN3O2S — CID 111634731
1-(2,2-dimethyl-4-methylsulfonylbutyl)-2-methyl-3-[(4-methylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111634731) has the molecular formula C17H30IN3O2S and a molecular weight of 467.42 g/mol. Its IUPAC name is 1-(2,2-dimethyl-4-methylsulfonylbutyl)-2-methyl-3-[(4-methylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(2,2-dimethyl-4-methylsulfonylbutyl)-2-methyl-3-[(4-methylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111634731 |
| Molecular Formula | C17H30IN3O2S |
| Molecular Weight | 467.42 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | 1-(2,2-dimethyl-4-methylsulfonylbutyl)-2-methyl-3-[(4-methylphenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(C)cc1)NCC(C)(C)CCS(C)(=O)=O.I |
| InChI | InChI=1S/C17H29N3O2S.HI/c1-14-6-8-15(9-7-14)12-19-16(18-4)20-13-17(2,3)10-11-23(5,21)22;/h6-9H,10-13H2,1-5H3,(H2,18,19,20);1H |
| InChIKey | NUYOPFSTSCNPRD-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.42 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|