C20H35N3O3S — CID 111634993
1-(2,2-dimethyl-4-methylsulfonylbutyl)-2-methyl-3-(2-methyl-3-phenylmethoxypropyl)guanidine (PubChem CID 111634993) has the molecular formula C20H35N3O3S and a molecular weight of 397.59 g/mol. Its IUPAC name is 1-(2,2-dimethyl-4-methylsulfonylbutyl)-2-methyl-3-(2-methyl-3-phenylmethoxypropyl)guanidine.
| Compound Name | 1-(2,2-dimethyl-4-methylsulfonylbutyl)-2-methyl-3-(2-methyl-3-phenylmethoxypropyl)guanidine |
|---|---|
| PubChem CID | 111634993 |
| Molecular Formula | C20H35N3O3S |
| Molecular Weight | 397.59 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | 1-(2,2-dimethyl-4-methylsulfonylbutyl)-2-methyl-3-(2-methyl-3-phenylmethoxypropyl)guanidine |
| SMILES | C/N=C(/NCC(C)COCc1ccccc1)NCC(C)(C)CCS(C)(=O)=O |
| InChI | InChI=1S/C20H35N3O3S/c1-17(14-26-15-18-9-7-6-8-10-18)13-22-19(21-4)23-16-20(2,3)11-12-27(5,24)25/h6-10,17H,11-16H2,1-5H3,(H2,21,22,23) |
| InChIKey | OOAREEVAGJRVJG-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.59 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|