C16H35N3O3S — CID 111634883
1-(2,2-dimethyl-4-methylsulfonylbutyl)-2-methyl-3-[3-(2-methylpropoxy)propyl]guanidine (PubChem CID 111634883) has the molecular formula C16H35N3O3S and a molecular weight of 349.54 g/mol. Its IUPAC name is 1-(2,2-dimethyl-4-methylsulfonylbutyl)-2-methyl-3-[3-(2-methylpropoxy)propyl]guanidine.
| Compound Name | 1-(2,2-dimethyl-4-methylsulfonylbutyl)-2-methyl-3-[3-(2-methylpropoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111634883 |
| Molecular Formula | C16H35N3O3S |
| Molecular Weight | 349.54 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | 1-(2,2-dimethyl-4-methylsulfonylbutyl)-2-methyl-3-[3-(2-methylpropoxy)propyl]guanidine |
| SMILES | C/N=C(\NCCCOCC(C)C)NCC(C)(C)CCS(C)(=O)=O |
| InChI | InChI=1S/C16H35N3O3S/c1-14(2)12-22-10-7-9-18-15(17-5)19-13-16(3,4)8-11-23(6,20)21/h14H,7-13H2,1-6H3,(H2,17,18,19) |
| InChIKey | MYKABIJQFZWICW-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.54 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|