C21H38IN3O2S — CID 111979818
1-(2,2-dimethyl-4-methylsulfonylbutyl)-2-methyl-3-[3-(4-propan-2-ylphenyl)propyl]guanidine;hydroiodide (PubChem CID 111979818) has the molecular formula C21H38IN3O2S and a molecular weight of 523.53 g/mol. Its IUPAC name is 1-(2,2-dimethyl-4-methylsulfonylbutyl)-2-methyl-3-[3-(4-propan-2-ylphenyl)propyl]guanidine;hydroiodide.
| Compound Name | 1-(2,2-dimethyl-4-methylsulfonylbutyl)-2-methyl-3-[3-(4-propan-2-ylphenyl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111979818 |
| Molecular Formula | C21H38IN3O2S |
| Molecular Weight | 523.53 g/mol |
| Exact Mass | 523.17 |
| IUPAC Name | 1-(2,2-dimethyl-4-methylsulfonylbutyl)-2-methyl-3-[3-(4-propan-2-ylphenyl)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCCc1ccc(C(C)C)cc1)NCC(C)(C)CCS(C)(=O)=O.I |
| InChI | InChI=1S/C21H37N3O2S.HI/c1-17(2)19-11-9-18(10-12-19)8-7-14-23-20(22-5)24-16-21(3,4)13-15-27(6,25)26;/h9-12,17H,7-8,13-16H2,1-6H3,(H2,22,23,24);1H |
| InChIKey | JNUJSMKKCAOGAP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.53 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|