C21H37IN4O — CID 111549148
2,2-dimethyl-N-[2-[[N'-methyl-N-[3-(4-propan-2-ylphenyl)propyl]carbamimidoyl]amino]ethyl]propanamide;hydroiodide (PubChem CID 111549148) has the molecular formula C21H37IN4O and a molecular weight of 488.46 g/mol. Its IUPAC name is 2,2-dimethyl-N-[2-[[N'-methyl-N-[3-(4-propan-2-ylphenyl)propyl]carbamimidoyl]amino]ethyl]propanamide;hydroiodide.
| Compound Name | 2,2-dimethyl-N-[2-[[N'-methyl-N-[3-(4-propan-2-ylphenyl)propyl]carbamimidoyl]amino]ethyl]propanamide;hydroiodide |
|---|---|
| PubChem CID | 111549148 |
| Molecular Formula | C21H37IN4O |
| Molecular Weight | 488.46 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | 2,2-dimethyl-N-[2-[[N'-methyl-N-[3-(4-propan-2-ylphenyl)propyl]carbamimidoyl]amino]ethyl]propanamide;hydroiodide |
| SMILES | C/N=C(/NCCCc1ccc(C(C)C)cc1)NCCNC(=O)C(C)(C)C.I |
| InChI | InChI=1S/C21H36N4O.HI/c1-16(2)18-11-9-17(10-12-18)8-7-13-24-20(22-6)25-15-14-23-19(26)21(3,4)5;/h9-12,16H,7-8,13-15H2,1-6H3,(H,23,26)(H2,22,24,25);1H |
| InChIKey | VDGHMRJTJXKRBO-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.46 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|