C19H34IN3O3S — CID 111573522
1-(2-tert-butylsulfonylethyl)-2-methyl-3-(2-methyl-3-phenylmethoxypropyl)guanidine;hydroiodide (PubChem CID 111573522) has the molecular formula C19H34IN3O3S and a molecular weight of 511.47 g/mol. Its IUPAC name is 1-(2-tert-butylsulfonylethyl)-2-methyl-3-(2-methyl-3-phenylmethoxypropyl)guanidine;hydroiodide.
| Compound Name | 1-(2-tert-butylsulfonylethyl)-2-methyl-3-(2-methyl-3-phenylmethoxypropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111573522 |
| Molecular Formula | C19H34IN3O3S |
| Molecular Weight | 511.47 g/mol |
| Exact Mass | 511.14 |
| IUPAC Name | 1-(2-tert-butylsulfonylethyl)-2-methyl-3-(2-methyl-3-phenylmethoxypropyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCS(=O)(=O)C(C)(C)C)NCC(C)COCc1ccccc1.I |
| InChI | InChI=1S/C19H33N3O3S.HI/c1-16(14-25-15-17-9-7-6-8-10-17)13-22-18(20-5)21-11-12-26(23,24)19(2,3)4;/h6-10,16H,11-15H2,1-5H3,(H2,20,21,22);1H |
| InChIKey | DQVANWLJWCXNIJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.47 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|