C18H28F3N3O3S — CID 111634778
1-(2,2-dimethyl-4-methylsulfonylbutyl)-2-methyl-3-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine (PubChem CID 111634778) has the molecular formula C18H28F3N3O3S and a molecular weight of 423.50 g/mol. Its IUPAC name is 1-(2,2-dimethyl-4-methylsulfonylbutyl)-2-methyl-3-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine.
| Compound Name | 1-(2,2-dimethyl-4-methylsulfonylbutyl)-2-methyl-3-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111634778 |
| Molecular Formula | C18H28F3N3O3S |
| Molecular Weight | 423.50 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 1-(2,2-dimethyl-4-methylsulfonylbutyl)-2-methyl-3-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine |
| SMILES | C/N=C(/NCc1ccc(OCC(F)(F)F)cc1)NCC(C)(C)CCS(C)(=O)=O |
| InChI | InChI=1S/C18H28F3N3O3S/c1-17(2,9-10-28(4,25)26)12-24-16(22-3)23-11-14-5-7-15(8-6-14)27-13-18(19,20)21/h5-8H,9-13H2,1-4H3,(H2,22,23,24) |
| InChIKey | HVUPYKDWMQSXSS-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.50 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|