C18H20F3IN4O3 — CID 111871558
2-methyl-1-[(4-nitrophenyl)methyl]-3-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111871558) has the molecular formula C18H20F3IN4O3 and a molecular weight of 524.28 g/mol. Its IUPAC name is 2-methyl-1-[(4-nitrophenyl)methyl]-3-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(4-nitrophenyl)methyl]-3-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111871558 |
| Molecular Formula | C18H20F3IN4O3 |
| Molecular Weight | 524.28 g/mol |
| Exact Mass | 524.05 |
| IUPAC Name | 2-methyl-1-[(4-nitrophenyl)methyl]-3-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(OCC(F)(F)F)cc1)NCc1ccc([N+](=O)[O-])cc1.I |
| InChI | InChI=1S/C18H19F3N4O3.HI/c1-22-17(23-10-13-2-6-15(7-3-13)25(26)27)24-11-14-4-8-16(9-5-14)28-12-18(19,20)21;/h2-9H,10-12H2,1H3,(H2,22,23,24);1H |
| InChIKey | MCVADHXCBAIBES-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.28 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|