C11H24N4O — CID 111124289
N-tert-butyl-2-[(N'-methyl-N-propan-2-ylcarbamimidoyl)amino]acetamide (PubChem CID 111124289) has the molecular formula C11H24N4O and a molecular weight of 228.34 g/mol. Its IUPAC name is N-tert-butyl-2-[(N'-methyl-N-propan-2-ylcarbamimidoyl)amino]acetamide.
| Compound Name | N-tert-butyl-2-[(N'-methyl-N-propan-2-ylcarbamimidoyl)amino]acetamide |
|---|---|
| PubChem CID | 111124289 |
| Molecular Formula | C11H24N4O |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.20 |
| IUPAC Name | N-tert-butyl-2-[(N'-methyl-N-propan-2-ylcarbamimidoyl)amino]acetamide |
| SMILES | C/N=C(/NCC(=O)NC(C)(C)C)NC(C)C |
| InChI | InChI=1S/C11H24N4O/c1-8(2)14-10(12-6)13-7-9(16)15-11(3,4)5/h8H,7H2,1-6H3,(H,15,16)(H2,12,13,14) |
| InChIKey | WBFNHXNXZQHTMW-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|