C13H25F3IN5O2 — CID 111501504
N-tert-butyl-2-[[N'-methyl-N-[2-[methyl(2,2,2-trifluoroethyl)amino]-2-oxoethyl]carbamimidoyl]amino]acetamide;hydroiodide (PubChem CID 111501504) has the molecular formula C13H25F3IN5O2 and a molecular weight of 467.27 g/mol. Its IUPAC name is N-tert-butyl-2-[[N'-methyl-N-[2-[methyl(2,2,2-trifluoroethyl)amino]-2-oxoethyl]carbamimidoyl]amino]acetamide;hydroiodide.
| Compound Name | N-tert-butyl-2-[[N'-methyl-N-[2-[methyl(2,2,2-trifluoroethyl)amino]-2-oxoethyl]carbamimidoyl]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111501504 |
| Molecular Formula | C13H25F3IN5O2 |
| Molecular Weight | 467.27 g/mol |
| Exact Mass | 467.10 |
| IUPAC Name | N-tert-butyl-2-[[N'-methyl-N-[2-[methyl(2,2,2-trifluoroethyl)amino]-2-oxoethyl]carbamimidoyl]amino]acetamide;hydroiodide |
| SMILES | C/N=C(\NCC(=O)NC(C)(C)C)NCC(=O)N(C)CC(F)(F)F.I |
| InChI | InChI=1S/C13H24F3N5O2.HI/c1-12(2,3)20-9(22)6-18-11(17-4)19-7-10(23)21(5)8-13(14,15)16;/h6-8H2,1-5H3,(H,20,22)(H2,17,18,19);1H |
| InChIKey | NPVMQJBZRXVABE-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.27 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|