C19H29F3N4O — CID 111385210
N-tert-butyl-2-[[N'-methyl-N-[2-methyl-2-[3-(trifluoromethyl)phenyl]propyl]carbamimidoyl]amino]acetamide (PubChem CID 111385210) has the molecular formula C19H29F3N4O and a molecular weight of 386.46 g/mol. Its IUPAC name is N-tert-butyl-2-[[N'-methyl-N-[2-methyl-2-[3-(trifluoromethyl)phenyl]propyl]carbamimidoyl]amino]acetamide.
| Compound Name | N-tert-butyl-2-[[N'-methyl-N-[2-methyl-2-[3-(trifluoromethyl)phenyl]propyl]carbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111385210 |
| Molecular Formula | C19H29F3N4O |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | N-tert-butyl-2-[[N'-methyl-N-[2-methyl-2-[3-(trifluoromethyl)phenyl]propyl]carbamimidoyl]amino]acetamide |
| SMILES | C/N=C(\NCC(=O)NC(C)(C)C)NCC(C)(C)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H29F3N4O/c1-17(2,3)26-15(27)11-24-16(23-6)25-12-18(4,5)13-8-7-9-14(10-13)19(20,21)22/h7-10H,11-12H2,1-6H3,(H,26,27)(H2,23,24,25) |
| InChIKey | WJCWOWKLHRGPDE-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|