C21H32F3IN4O2 — CID 111385087
N-tert-butyl-2-[[N'-methyl-N-[[4-[3-(trifluoromethyl)phenyl]oxan-4-yl]methyl]carbamimidoyl]amino]acetamide;hydroiodide (PubChem CID 111385087) has the molecular formula C21H32F3IN4O2 and a molecular weight of 556.41 g/mol. Its IUPAC name is N-tert-butyl-2-[[N'-methyl-N-[[4-[3-(trifluoromethyl)phenyl]oxan-4-yl]methyl]carbamimidoyl]amino]acetamide;hydroiodide.
| Compound Name | N-tert-butyl-2-[[N'-methyl-N-[[4-[3-(trifluoromethyl)phenyl]oxan-4-yl]methyl]carbamimidoyl]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111385087 |
| Molecular Formula | C21H32F3IN4O2 |
| Molecular Weight | 556.41 g/mol |
| Exact Mass | 556.15 |
| IUPAC Name | N-tert-butyl-2-[[N'-methyl-N-[[4-[3-(trifluoromethyl)phenyl]oxan-4-yl]methyl]carbamimidoyl]amino]acetamide;hydroiodide |
| SMILES | C/N=C(\NCC(=O)NC(C)(C)C)NCC1(c2cccc(C(F)(F)F)c2)CCOCC1.I |
| InChI | InChI=1S/C21H31F3N4O2.HI/c1-19(2,3)28-17(29)13-26-18(25-4)27-14-20(8-10-30-11-9-20)15-6-5-7-16(12-15)21(22,23)24;/h5-7,12H,8-11,13-14H2,1-4H3,(H,28,29)(H2,25,26,27);1H |
| InChIKey | XJGVEWWZSLARRN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.41 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|