C22H27F3IN3O — CID 110952419
1-benzyl-2-methyl-3-[[4-[3-(trifluoromethyl)phenyl]oxan-4-yl]methyl]guanidine;hydroiodide (PubChem CID 110952419) has the molecular formula C22H27F3IN3O and a molecular weight of 533.38 g/mol. Its IUPAC name is 1-benzyl-2-methyl-3-[[4-[3-(trifluoromethyl)phenyl]oxan-4-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-benzyl-2-methyl-3-[[4-[3-(trifluoromethyl)phenyl]oxan-4-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110952419 |
| Molecular Formula | C22H27F3IN3O |
| Molecular Weight | 533.38 g/mol |
| Exact Mass | 533.12 |
| IUPAC Name | 1-benzyl-2-methyl-3-[[4-[3-(trifluoromethyl)phenyl]oxan-4-yl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccccc1)NCC1(c2cccc(C(F)(F)F)c2)CCOCC1.I |
| InChI | InChI=1S/C22H26F3N3O.HI/c1-26-20(27-15-17-6-3-2-4-7-17)28-16-21(10-12-29-13-11-21)18-8-5-9-19(14-18)22(23,24)25;/h2-9,14H,10-13,15-16H2,1H3,(H2,26,27,28);1H |
| InChIKey | YEKQEFSDRUEPIQ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.38 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|