C23H27F3N4O — CID 111687262
N-methyl-3-[[[N'-methyl-N-[[1-[3-(trifluoromethyl)phenyl]cyclobutyl]methyl]carbamimidoyl]amino]methyl]benzamide (PubChem CID 111687262) has the molecular formula C23H27F3N4O and a molecular weight of 432.49 g/mol. Its IUPAC name is N-methyl-3-[[[N'-methyl-N-[[1-[3-(trifluoromethyl)phenyl]cyclobutyl]methyl]carbamimidoyl]amino]methyl]benzamide.
| Compound Name | N-methyl-3-[[[N'-methyl-N-[[1-[3-(trifluoromethyl)phenyl]cyclobutyl]methyl]carbamimidoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 111687262 |
| Molecular Formula | C23H27F3N4O |
| Molecular Weight | 432.49 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | N-methyl-3-[[[N'-methyl-N-[[1-[3-(trifluoromethyl)phenyl]cyclobutyl]methyl]carbamimidoyl]amino]methyl]benzamide |
| SMILES | C/N=C(\NCc1cccc(C(=O)NC)c1)NCC1(c2cccc(C(F)(F)F)c2)CCC1 |
| InChI | InChI=1S/C23H27F3N4O/c1-27-20(31)17-7-3-6-16(12-17)14-29-21(28-2)30-15-22(10-5-11-22)18-8-4-9-19(13-18)23(24,25)26/h3-4,6-9,12-13H,5,10-11,14-15H2,1-2H3,(H,27,31)(H2,28,29,30) |
| InChIKey | QTBQFFVJSZEBBW-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.49 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|