C19H27F3N4O — CID 111687338
N,N-dimethyl-3-[[N'-methyl-N-[[1-[3-(trifluoromethyl)phenyl]cyclobutyl]methyl]carbamimidoyl]amino]propanamide (PubChem CID 111687338) has the molecular formula C19H27F3N4O and a molecular weight of 384.45 g/mol. Its IUPAC name is N,N-dimethyl-3-[[N'-methyl-N-[[1-[3-(trifluoromethyl)phenyl]cyclobutyl]methyl]carbamimidoyl]amino]propanamide.
| Compound Name | N,N-dimethyl-3-[[N'-methyl-N-[[1-[3-(trifluoromethyl)phenyl]cyclobutyl]methyl]carbamimidoyl]amino]propanamide |
|---|---|
| PubChem CID | 111687338 |
| Molecular Formula | C19H27F3N4O |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | N,N-dimethyl-3-[[N'-methyl-N-[[1-[3-(trifluoromethyl)phenyl]cyclobutyl]methyl]carbamimidoyl]amino]propanamide |
| SMILES | C/N=C(\NCCC(=O)N(C)C)NCC1(c2cccc(C(F)(F)F)c2)CCC1 |
| InChI | InChI=1S/C19H27F3N4O/c1-23-17(24-11-8-16(27)26(2)3)25-13-18(9-5-10-18)14-6-4-7-15(12-14)19(20,21)22/h4,6-7,12H,5,8-11,13H2,1-3H3,(H2,23,24,25) |
| InChIKey | YNVDFRKTADCHIY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|