C17H23F3IN3 — CID 111495065
2-methyl-1-prop-2-enyl-3-[[1-[3-(trifluoromethyl)phenyl]cyclobutyl]methyl]guanidine;hydroiodide (PubChem CID 111495065) has the molecular formula C17H23F3IN3 and a molecular weight of 453.29 g/mol. Its IUPAC name is 2-methyl-1-prop-2-enyl-3-[[1-[3-(trifluoromethyl)phenyl]cyclobutyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-prop-2-enyl-3-[[1-[3-(trifluoromethyl)phenyl]cyclobutyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111495065 |
| Molecular Formula | C17H23F3IN3 |
| Molecular Weight | 453.29 g/mol |
| Exact Mass | 453.09 |
| IUPAC Name | 2-methyl-1-prop-2-enyl-3-[[1-[3-(trifluoromethyl)phenyl]cyclobutyl]methyl]guanidine;hydroiodide |
| SMILES | C=CCN/C(=N\C)NCC1(c2cccc(C(F)(F)F)c2)CCC1.I |
| InChI | InChI=1S/C17H22F3N3.HI/c1-3-10-22-15(21-2)23-12-16(8-5-9-16)13-6-4-7-14(11-13)17(18,19)20;/h3-4,6-7,11H,1,5,8-10,12H2,2H3,(H2,21,22,23);1H |
| InChIKey | DFQHCYJDKNJAIP-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.29 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|