C21H28F3N3O — CID 109393626
1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-2-methyl-3-[[1-[3-(trifluoromethyl)phenyl]cyclobutyl]methyl]guanidine (PubChem CID 109393626) has the molecular formula C21H28F3N3O and a molecular weight of 395.47 g/mol. Its IUPAC name is 1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-2-methyl-3-[[1-[3-(trifluoromethyl)phenyl]cyclobutyl]methyl]guanidine.
| Compound Name | 1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-2-methyl-3-[[1-[3-(trifluoromethyl)phenyl]cyclobutyl]methyl]guanidine |
|---|---|
| PubChem CID | 109393626 |
| Molecular Formula | C21H28F3N3O |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | 1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-2-methyl-3-[[1-[3-(trifluoromethyl)phenyl]cyclobutyl]methyl]guanidine |
| SMILES | C/N=C(\NCCC1=CCOCC1)NCC1(c2cccc(C(F)(F)F)c2)CCC1 |
| InChI | InChI=1S/C21H28F3N3O/c1-25-19(26-11-6-16-7-12-28-13-8-16)27-15-20(9-3-10-20)17-4-2-5-18(14-17)21(22,23)24/h2,4-5,7,14H,3,6,8-13,15H2,1H3,(H2,25,26,27) |
| InChIKey | UPZPKOOMYKUUKT-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|