C22H32F3IN4O — CID 109394792
1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-2-methyl-3-[1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]guanidine;hydroiodide (PubChem CID 109394792) has the molecular formula C22H32F3IN4O and a molecular weight of 552.42 g/mol. Its IUPAC name is 1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-2-methyl-3-[1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]guanidine;hydroiodide.
| Compound Name | 1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-2-methyl-3-[1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109394792 |
| Molecular Formula | C22H32F3IN4O |
| Molecular Weight | 552.42 g/mol |
| Exact Mass | 552.16 |
| IUPAC Name | 1-[2-(3,6-dihydro-2H-pyran-4-yl)ethyl]-2-methyl-3-[1-[[3-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCC1=CCOCC1)NC1CCN(Cc2cccc(C(F)(F)F)c2)CC1.I |
| InChI | InChI=1S/C22H31F3N4O.HI/c1-26-21(27-10-5-17-8-13-30-14-9-17)28-20-6-11-29(12-7-20)16-18-3-2-4-19(15-18)22(23,24)25;/h2-4,8,15,20H,5-7,9-14,16H2,1H3,(H2,26,27,28);1H |
| InChIKey | LHXFPDIZKMQZIA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.42 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|