C24H27F3N4 — CID 111548785
1-(1-benzylpiperidin-4-yl)-2-methyl-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine (PubChem CID 111548785) has the molecular formula C24H27F3N4 and a molecular weight of 428.50 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-4-yl)-2-methyl-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine.
| Compound Name | 1-(1-benzylpiperidin-4-yl)-2-methyl-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine |
|---|---|
| PubChem CID | 111548785 |
| Molecular Formula | C24H27F3N4 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 1-(1-benzylpiperidin-4-yl)-2-methyl-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine |
| SMILES | C/N=C(\NCC#Cc1cccc(C(F)(F)F)c1)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C24H27F3N4/c1-28-23(29-14-6-10-19-9-5-11-21(17-19)24(25,26)27)30-22-12-15-31(16-13-22)18-20-7-3-2-4-8-20/h2-5,7-9,11,17,22H,12-16,18H2,1H3,(H2,28,29,30) |
| InChIKey | TYMFUTKCAPVFIA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|