C20H21F3IN3 — CID 111545650
2-methyl-1-(1-phenylethyl)-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine;hydroiodide (PubChem CID 111545650) has the molecular formula C20H21F3IN3 and a molecular weight of 487.31 g/mol. Its IUPAC name is 2-methyl-1-(1-phenylethyl)-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(1-phenylethyl)-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111545650 |
| Molecular Formula | C20H21F3IN3 |
| Molecular Weight | 487.31 g/mol |
| Exact Mass | 487.07 |
| IUPAC Name | 2-methyl-1-(1-phenylethyl)-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCC#Cc1cccc(C(F)(F)F)c1)NC(C)c1ccccc1.I |
| InChI | InChI=1S/C20H20F3N3.HI/c1-15(17-10-4-3-5-11-17)26-19(24-2)25-13-7-9-16-8-6-12-18(14-16)20(21,22)23;/h3-6,8,10-12,14-15H,13H2,1-2H3,(H2,24,25,26);1H |
| InChIKey | IZRJEQNSBPYIKU-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.31 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|