C21H31F3N4 — CID 111754931
1-[5-(diethylamino)pentan-2-yl]-2-methyl-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine (PubChem CID 111754931) has the molecular formula C21H31F3N4 and a molecular weight of 396.50 g/mol. Its IUPAC name is 1-[5-(diethylamino)pentan-2-yl]-2-methyl-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine.
| Compound Name | 1-[5-(diethylamino)pentan-2-yl]-2-methyl-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine |
|---|---|
| PubChem CID | 111754931 |
| Molecular Formula | C21H31F3N4 |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | 1-[5-(diethylamino)pentan-2-yl]-2-methyl-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine |
| SMILES | CCN(CC)CCCC(C)N/C(=N\C)NCC#Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H31F3N4/c1-5-28(6-2)15-9-10-17(3)27-20(25-4)26-14-8-12-18-11-7-13-19(16-18)21(22,23)24/h7,11,13,16-17H,5-6,9-10,14-15H2,1-4H3,(H2,25,26,27) |
| InChIKey | IHBCDCKWYTTYMK-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|