C21H27F3N2OS — CID 46082931
N-[5-(diethylamino)pentan-2-yl]-5-[3-(trifluoromethyl)phenyl]thiophene-2-carboxamide (PubChem CID 46082931) has the molecular formula C21H27F3N2OS and a molecular weight of 412.52 g/mol. Its IUPAC name is N-[5-(diethylamino)pentan-2-yl]-5-[3-(trifluoromethyl)phenyl]thiophene-2-carboxamide.
| Compound Name | N-[5-(diethylamino)pentan-2-yl]-5-[3-(trifluoromethyl)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 46082931 |
| Molecular Formula | C21H27F3N2OS |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | N-[5-(diethylamino)pentan-2-yl]-5-[3-(trifluoromethyl)phenyl]thiophene-2-carboxamide |
| SMILES | CCN(CC)CCCC(C)NC(=O)c1ccc(-c2cccc(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C21H27F3N2OS/c1-4-26(5-2)13-7-8-15(3)25-20(27)19-12-11-18(28-19)16-9-6-10-17(14-16)21(22,23)24/h6,9-12,14-15H,4-5,7-8,13H2,1-3H3,(H,25,27) |
| InChIKey | PBWOIWUPCQYCDY-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |