C20H24F3NOS — CID 92760464
N-[(2S)-6-methylheptan-2-yl]-5-[3-(trifluoromethyl)phenyl]thiophene-2-carboxamide (PubChem CID 92760464) has the molecular formula C20H24F3NOS and a molecular weight of 383.48 g/mol. Its IUPAC name is N-[(2S)-6-methylheptan-2-yl]-5-[3-(trifluoromethyl)phenyl]thiophene-2-carboxamide.
| Compound Name | N-[(2S)-6-methylheptan-2-yl]-5-[3-(trifluoromethyl)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 92760464 |
| Molecular Formula | C20H24F3NOS |
| Molecular Weight | 383.48 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | N-[(2S)-6-methylheptan-2-yl]-5-[3-(trifluoromethyl)phenyl]thiophene-2-carboxamide |
| SMILES | CC(C)CCC[C@H](C)NC(=O)c1ccc(-c2cccc(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C20H24F3NOS/c1-13(2)6-4-7-14(3)24-19(25)18-11-10-17(26-18)15-8-5-9-16(12-15)20(21,22)23/h5,8-14H,4,6-7H2,1-3H3,(H,24,25)/t14-/m0/s1 |
| InChIKey | YSUQQQWMJXQXTR-AWEZNQCLSA-N |
| XLogP | 6.38 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.48 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |