C20H22F3NOS — CID 46083086
N-(cycloheptylmethyl)-5-[3-(trifluoromethyl)phenyl]thiophene-2-carboxamide (PubChem CID 46083086) has the molecular formula C20H22F3NOS and a molecular weight of 381.46 g/mol. Its IUPAC name is N-(cycloheptylmethyl)-5-[3-(trifluoromethyl)phenyl]thiophene-2-carboxamide.
| Compound Name | N-(cycloheptylmethyl)-5-[3-(trifluoromethyl)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 46083086 |
| Molecular Formula | C20H22F3NOS |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | N-(cycloheptylmethyl)-5-[3-(trifluoromethyl)phenyl]thiophene-2-carboxamide |
| SMILES | O=C(NCC1CCCCCC1)c1ccc(-c2cccc(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C20H22F3NOS/c21-20(22,23)16-9-5-8-15(12-16)17-10-11-18(26-17)19(25)24-13-14-6-3-1-2-4-7-14/h5,8-12,14H,1-4,6-7,13H2,(H,24,25) |
| InChIKey | USGBIPPDBPWTGM-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |