C21H22F3NOS — CID 46082788
N-cyclohexyl-N-prop-2-enyl-5-[3-(trifluoromethyl)phenyl]thiophene-2-carboxamide (PubChem CID 46082788) has the molecular formula C21H22F3NOS and a molecular weight of 393.47 g/mol. Its IUPAC name is N-cyclohexyl-N-prop-2-enyl-5-[3-(trifluoromethyl)phenyl]thiophene-2-carboxamide.
| Compound Name | N-cyclohexyl-N-prop-2-enyl-5-[3-(trifluoromethyl)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 46082788 |
| Molecular Formula | C21H22F3NOS |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | N-cyclohexyl-N-prop-2-enyl-5-[3-(trifluoromethyl)phenyl]thiophene-2-carboxamide |
| SMILES | C=CCN(C(=O)c1ccc(-c2cccc(C(F)(F)F)c2)s1)C1CCCCC1 |
| InChI | InChI=1S/C21H22F3NOS/c1-2-13-25(17-9-4-3-5-10-17)20(26)19-12-11-18(27-19)15-7-6-8-16(14-15)21(22,23)24/h2,6-8,11-12,14,17H,1,3-5,9-10,13H2 |
| InChIKey | SMWPGIZLKKGKCY-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|