C19H23NOS — CID 46082628
5-(4-cyclohexylphenyl)-N,N-dimethylthiophene-2-carboxamide (PubChem CID 46082628) has the molecular formula C19H23NOS and a molecular weight of 313.47 g/mol. Its IUPAC name is 5-(4-cyclohexylphenyl)-N,N-dimethylthiophene-2-carboxamide.
| Compound Name | 5-(4-cyclohexylphenyl)-N,N-dimethylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 46082628 |
| Molecular Formula | C19H23NOS |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 5-(4-cyclohexylphenyl)-N,N-dimethylthiophene-2-carboxamide |
| SMILES | CN(C)C(=O)c1ccc(-c2ccc(C3CCCCC3)cc2)s1 |
| InChI | InChI=1S/C19H23NOS/c1-20(2)19(21)18-13-12-17(22-18)16-10-8-15(9-11-16)14-6-4-3-5-7-14/h8-14H,3-7H2,1-2H3 |
| InChIKey | RCSWOTZLJIFVIW-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |