C17H19BrN2OS — CID 119442269
5-(4-bromophenyl)-N-methyl-N-piperidin-4-ylthiophene-2-carboxamide (PubChem CID 119442269) has the molecular formula C17H19BrN2OS and a molecular weight of 379.32 g/mol. Its IUPAC name is 5-(4-bromophenyl)-N-methyl-N-piperidin-4-ylthiophene-2-carboxamide.
| Compound Name | 5-(4-bromophenyl)-N-methyl-N-piperidin-4-ylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 119442269 |
| Molecular Formula | C17H19BrN2OS |
| Molecular Weight | 379.32 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | 5-(4-bromophenyl)-N-methyl-N-piperidin-4-ylthiophene-2-carboxamide |
| SMILES | CN(C(=O)c1ccc(-c2ccc(Br)cc2)s1)C1CCNCC1 |
| InChI | InChI=1S/C17H19BrN2OS/c1-20(14-8-10-19-11-9-14)17(21)16-7-6-15(22-16)12-2-4-13(18)5-3-12/h2-7,14,19H,8-11H2,1H3 |
| InChIKey | SQTSSZDGRDUUEC-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.32 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |