C17H21ClN2O3S2 — CID 119441510
5-(benzenesulfonyl)-N-methyl-N-piperidin-4-ylthiophene-2-carboxamide;hydrochloride (PubChem CID 119441510) has the molecular formula C17H21ClN2O3S2 and a molecular weight of 400.95 g/mol. Its IUPAC name is 5-(benzenesulfonyl)-N-methyl-N-piperidin-4-ylthiophene-2-carboxamide;hydrochloride.
| Compound Name | 5-(benzenesulfonyl)-N-methyl-N-piperidin-4-ylthiophene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119441510 |
| Molecular Formula | C17H21ClN2O3S2 |
| Molecular Weight | 400.95 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | 5-(benzenesulfonyl)-N-methyl-N-piperidin-4-ylthiophene-2-carboxamide;hydrochloride |
| SMILES | CN(C(=O)c1ccc(S(=O)(=O)c2ccccc2)s1)C1CCNCC1.Cl |
| InChI | InChI=1S/C17H20N2O3S2.ClH/c1-19(13-9-11-18-12-10-13)17(20)15-7-8-16(23-15)24(21,22)14-5-3-2-4-6-14;/h2-8,13,18H,9-12H2,1H3;1H |
| InChIKey | KQKACHSAWUVQTR-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.95 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |