C16H19ClN2O3S2 — CID 119576701
[5-(benzenesulfonyl)thiophen-2-yl]-(3-methylpiperazin-1-yl)methanone;hydrochloride (PubChem CID 119576701) has the molecular formula C16H19ClN2O3S2 and a molecular weight of 386.93 g/mol. Its IUPAC name is [5-(benzenesulfonyl)thiophen-2-yl]-(3-methylpiperazin-1-yl)methanone;hydrochloride.
| Compound Name | [5-(benzenesulfonyl)thiophen-2-yl]-(3-methylpiperazin-1-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119576701 |
| Molecular Formula | C16H19ClN2O3S2 |
| Molecular Weight | 386.93 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | [5-(benzenesulfonyl)thiophen-2-yl]-(3-methylpiperazin-1-yl)methanone;hydrochloride |
| SMILES | CC1CN(C(=O)c2ccc(S(=O)(=O)c3ccccc3)s2)CCN1.Cl |
| InChI | InChI=1S/C16H18N2O3S2.ClH/c1-12-11-18(10-9-17-12)16(19)14-7-8-15(22-14)23(20,21)13-5-3-2-4-6-13;/h2-8,12,17H,9-11H2,1H3;1H |
| InChIKey | AXJYHZKILLDRKU-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.93 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |