C16H18N2O3S2 — CID 119483665
[3-(aminomethyl)pyrrolidin-1-yl]-[5-(benzenesulfonyl)thiophen-2-yl]methanone (PubChem CID 119483665) has the molecular formula C16H18N2O3S2 and a molecular weight of 350.46 g/mol. Its IUPAC name is [3-(aminomethyl)pyrrolidin-1-yl]-[5-(benzenesulfonyl)thiophen-2-yl]methanone.
| Compound Name | [3-(aminomethyl)pyrrolidin-1-yl]-[5-(benzenesulfonyl)thiophen-2-yl]methanone |
|---|---|
| PubChem CID | 119483665 |
| Molecular Formula | C16H18N2O3S2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | [3-(aminomethyl)pyrrolidin-1-yl]-[5-(benzenesulfonyl)thiophen-2-yl]methanone |
| SMILES | NCC1CCN(C(=O)c2ccc(S(=O)(=O)c3ccccc3)s2)C1 |
| InChI | InChI=1S/C16H18N2O3S2/c17-10-12-8-9-18(11-12)16(19)14-6-7-15(22-14)23(20,21)13-4-2-1-3-5-13/h1-7,12H,8-11,17H2 |
| InChIKey | UKQLQRPHTKNYBJ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |