C16H17ClN2OS — CID 119485306
[3-(aminomethyl)pyrrolidin-1-yl]-[5-(4-chlorophenyl)thiophen-2-yl]methanone (PubChem CID 119485306) has the molecular formula C16H17ClN2OS and a molecular weight of 320.85 g/mol. Its IUPAC name is [3-(aminomethyl)pyrrolidin-1-yl]-[5-(4-chlorophenyl)thiophen-2-yl]methanone.
| Compound Name | [3-(aminomethyl)pyrrolidin-1-yl]-[5-(4-chlorophenyl)thiophen-2-yl]methanone |
|---|---|
| PubChem CID | 119485306 |
| Molecular Formula | C16H17ClN2OS |
| Molecular Weight | 320.85 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | [3-(aminomethyl)pyrrolidin-1-yl]-[5-(4-chlorophenyl)thiophen-2-yl]methanone |
| SMILES | NCC1CCN(C(=O)c2ccc(-c3ccc(Cl)cc3)s2)C1 |
| InChI | InChI=1S/C16H17ClN2OS/c17-13-3-1-12(2-4-13)14-5-6-15(21-14)16(20)19-8-7-11(9-18)10-19/h1-6,11H,7-10,18H2 |
| InChIKey | GBSLYSFFCBGMCA-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.85 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |