C16H18ClFN2OS — CID 119377231
(3-aminopiperidin-1-yl)-[5-(4-fluorophenyl)thiophen-2-yl]methanone;hydrochloride (PubChem CID 119377231) has the molecular formula C16H18ClFN2OS and a molecular weight of 340.85 g/mol. Its IUPAC name is (3-aminopiperidin-1-yl)-[5-(4-fluorophenyl)thiophen-2-yl]methanone;hydrochloride.
| Compound Name | (3-aminopiperidin-1-yl)-[5-(4-fluorophenyl)thiophen-2-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119377231 |
| Molecular Formula | C16H18ClFN2OS |
| Molecular Weight | 340.85 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | (3-aminopiperidin-1-yl)-[5-(4-fluorophenyl)thiophen-2-yl]methanone;hydrochloride |
| SMILES | Cl.NC1CCCN(C(=O)c2ccc(-c3ccc(F)cc3)s2)C1 |
| InChI | InChI=1S/C16H17FN2OS.ClH/c17-12-5-3-11(4-6-12)14-7-8-15(21-14)16(20)19-9-1-2-13(18)10-19;/h3-8,13H,1-2,9-10,18H2;1H |
| InChIKey | GMWPVFXAEVXSKN-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.85 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |