C18H20FNOS — CID 97023625
[5-(4-fluorophenyl)thiophen-2-yl]-[(4S)-4-methylazepan-1-yl]methanone (PubChem CID 97023625) has the molecular formula C18H20FNOS and a molecular weight of 317.43 g/mol. Its IUPAC name is [5-(4-fluorophenyl)thiophen-2-yl]-[(4S)-4-methylazepan-1-yl]methanone.
| Compound Name | [5-(4-fluorophenyl)thiophen-2-yl]-[(4S)-4-methylazepan-1-yl]methanone |
|---|---|
| PubChem CID | 97023625 |
| Molecular Formula | C18H20FNOS |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | [5-(4-fluorophenyl)thiophen-2-yl]-[(4S)-4-methylazepan-1-yl]methanone |
| SMILES | C[C@H]1CCCN(C(=O)c2ccc(-c3ccc(F)cc3)s2)CC1 |
| InChI | InChI=1S/C18H20FNOS/c1-13-3-2-11-20(12-10-13)18(21)17-9-8-16(22-17)14-4-6-15(19)7-5-14/h4-9,13H,2-3,10-12H2,1H3/t13-/m0/s1 |
| InChIKey | YLQYOYKRKRZLFP-ZDUSSCGKSA-N |
| XLogP | 4.82 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |