C22H26FN3O4S — CID 46657166
tert-butyl 4-[[[5-(4-fluorophenyl)thiophene-2-carbonyl]amino]carbamoyl]piperidine-1-carboxylate (PubChem CID 46657166) has the molecular formula C22H26FN3O4S and a molecular weight of 447.53 g/mol. Its IUPAC name is tert-butyl 4-[[[5-(4-fluorophenyl)thiophene-2-carbonyl]amino]carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[[5-(4-fluorophenyl)thiophene-2-carbonyl]amino]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 46657166 |
| Molecular Formula | C22H26FN3O4S |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | tert-butyl 4-[[[5-(4-fluorophenyl)thiophene-2-carbonyl]amino]carbamoyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(=O)NNC(=O)c2ccc(-c3ccc(F)cc3)s2)CC1 |
| InChI | InChI=1S/C22H26FN3O4S/c1-22(2,3)30-21(29)26-12-10-15(11-13-26)19(27)24-25-20(28)18-9-8-17(31-18)14-4-6-16(23)7-5-14/h4-9,15H,10-13H2,1-3H3,(H,24,27)(H,25,28) |
| InChIKey | IRYWQPLNDQNSNI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|