C19H20FN3O3S — CID 9182764
ethyl 4-[[5-(4-fluorophenyl)thiophene-2-carbonyl]hydrazinylidene]piperidine-1-carboxylate (PubChem CID 9182764) has the molecular formula C19H20FN3O3S and a molecular weight of 389.45 g/mol. Its IUPAC name is ethyl 4-[[5-(4-fluorophenyl)thiophene-2-carbonyl]hydrazinylidene]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[5-(4-fluorophenyl)thiophene-2-carbonyl]hydrazinylidene]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 9182764 |
| Molecular Formula | C19H20FN3O3S |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | ethyl 4-[[5-(4-fluorophenyl)thiophene-2-carbonyl]hydrazinylidene]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(=NNC(=O)c2ccc(-c3ccc(F)cc3)s2)CC1 |
| InChI | InChI=1S/C19H20FN3O3S/c1-2-26-19(25)23-11-9-15(10-12-23)21-22-18(24)17-8-7-16(27-17)13-3-5-14(20)6-4-13/h3-8H,2,9-12H2,1H3,(H,22,24) |
| InChIKey | WDOBPSZYHACJLE-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|