C19H26N4O5S — CID 9466019
ethyl 4-[(4-pyrrolidin-1-ylsulfonylbenzoyl)hydrazinylidene]piperidine-1-carboxylate (PubChem CID 9466019) has the molecular formula C19H26N4O5S and a molecular weight of 422.51 g/mol. Its IUPAC name is ethyl 4-[(4-pyrrolidin-1-ylsulfonylbenzoyl)hydrazinylidene]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[(4-pyrrolidin-1-ylsulfonylbenzoyl)hydrazinylidene]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 9466019 |
| Molecular Formula | C19H26N4O5S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | ethyl 4-[(4-pyrrolidin-1-ylsulfonylbenzoyl)hydrazinylidene]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(=NNC(=O)c2ccc(S(=O)(=O)N3CCCC3)cc2)CC1 |
| InChI | InChI=1S/C19H26N4O5S/c1-2-28-19(25)22-13-9-16(10-14-22)20-21-18(24)15-5-7-17(8-6-15)29(26,27)23-11-3-4-12-23/h5-8H,2-4,9-14H2,1H3,(H,21,24) |
| InChIKey | NRQLWCBWSGFKNA-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 108.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|