C21H31N3O3S — CID 9466003
N-[(4-tert-butylcyclohexylidene)amino]-4-pyrrolidin-1-ylsulfonylbenzamide (PubChem CID 9466003) has the molecular formula C21H31N3O3S and a molecular weight of 405.56 g/mol. Its IUPAC name is N-[(4-tert-butylcyclohexylidene)amino]-4-pyrrolidin-1-ylsulfonylbenzamide.
| Compound Name | N-[(4-tert-butylcyclohexylidene)amino]-4-pyrrolidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 9466003 |
| Molecular Formula | C21H31N3O3S |
| Molecular Weight | 405.56 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | N-[(4-tert-butylcyclohexylidene)amino]-4-pyrrolidin-1-ylsulfonylbenzamide |
| SMILES | CC(C)(C)C1CCC(=NNC(=O)c2ccc(S(=O)(=O)N3CCCC3)cc2)CC1 |
| InChI | InChI=1S/C21H31N3O3S/c1-21(2,3)17-8-10-18(11-9-17)22-23-20(25)16-6-12-19(13-7-16)28(26,27)24-14-4-5-15-24/h6-7,12-13,17H,4-5,8-11,14-15H2,1-3H3,(H,23,25)/b22-18- |
| InChIKey | RQNYNPLSSPDAOV-PYCFMQQDSA-N |
| XLogP | 3.79 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.56 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|