C20H31N5O4S — CID 111163082
ethyl 4-[N'-methyl-N-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]carbamimidoyl]piperazine-1-carboxylate (PubChem CID 111163082) has the molecular formula C20H31N5O4S and a molecular weight of 437.57 g/mol. Its IUPAC name is ethyl 4-[N'-methyl-N-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]carbamimidoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[N'-methyl-N-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]carbamimidoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 111163082 |
| Molecular Formula | C20H31N5O4S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | ethyl 4-[N'-methyl-N-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]carbamimidoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(/C(=N\C)NCc2ccc(S(=O)(=O)N3CCCC3)cc2)CC1 |
| InChI | InChI=1S/C20H31N5O4S/c1-3-29-20(26)24-14-12-23(13-15-24)19(21-2)22-16-17-6-8-18(9-7-17)30(27,28)25-10-4-5-11-25/h6-9H,3-5,10-16H2,1-2H3,(H,21,22) |
| InChIKey | CAZCULJFGLWGST-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 94.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|