C20H33N5O3S — CID 111385780
N-tert-butyl-2-[[N'-methyl-N-[(4-piperidin-1-ylsulfonylphenyl)methyl]carbamimidoyl]amino]acetamide (PubChem CID 111385780) has the molecular formula C20H33N5O3S and a molecular weight of 423.58 g/mol. Its IUPAC name is N-tert-butyl-2-[[N'-methyl-N-[(4-piperidin-1-ylsulfonylphenyl)methyl]carbamimidoyl]amino]acetamide.
| Compound Name | N-tert-butyl-2-[[N'-methyl-N-[(4-piperidin-1-ylsulfonylphenyl)methyl]carbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111385780 |
| Molecular Formula | C20H33N5O3S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | N-tert-butyl-2-[[N'-methyl-N-[(4-piperidin-1-ylsulfonylphenyl)methyl]carbamimidoyl]amino]acetamide |
| SMILES | C/N=C(\NCC(=O)NC(C)(C)C)NCc1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C20H33N5O3S/c1-20(2,3)24-18(26)15-23-19(21-4)22-14-16-8-10-17(11-9-16)29(27,28)25-12-6-5-7-13-25/h8-11H,5-7,12-15H2,1-4H3,(H,24,26)(H2,21,22,23) |
| InChIKey | CSXCNRDIFOTSDW-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|