C21H33IN4O4S — CID 110993664
ethyl 1-[N'-methyl-N-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]carbamimidoyl]piperidine-3-carboxylate;hydroiodide (PubChem CID 110993664) has the molecular formula C21H33IN4O4S and a molecular weight of 564.49 g/mol. Its IUPAC name is ethyl 1-[N'-methyl-N-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]carbamimidoyl]piperidine-3-carboxylate;hydroiodide.
| Compound Name | ethyl 1-[N'-methyl-N-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]carbamimidoyl]piperidine-3-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 110993664 |
| Molecular Formula | C21H33IN4O4S |
| Molecular Weight | 564.49 g/mol |
| Exact Mass | 564.13 |
| IUPAC Name | ethyl 1-[N'-methyl-N-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]carbamimidoyl]piperidine-3-carboxylate;hydroiodide |
| SMILES | CCOC(=O)C1CCCN(/C(=N\C)NCc2ccc(S(=O)(=O)N3CCCC3)cc2)C1.I |
| InChI | InChI=1S/C21H32N4O4S.HI/c1-3-29-20(26)18-7-6-12-24(16-18)21(22-2)23-15-17-8-10-19(11-9-17)30(27,28)25-13-4-5-14-25;/h8-11,18H,3-7,12-16H2,1-2H3,(H,22,23);1H |
| InChIKey | RINIOAFITKSSAO-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 91.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.49 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|