C22H33IN4O3 — CID 110993084
ethyl 1-[N'-methyl-N-[[4-(2-oxopiperidin-1-yl)phenyl]methyl]carbamimidoyl]piperidine-3-carboxylate;hydroiodide (PubChem CID 110993084) has the molecular formula C22H33IN4O3 and a molecular weight of 528.44 g/mol. Its IUPAC name is ethyl 1-[N'-methyl-N-[[4-(2-oxopiperidin-1-yl)phenyl]methyl]carbamimidoyl]piperidine-3-carboxylate;hydroiodide.
| Compound Name | ethyl 1-[N'-methyl-N-[[4-(2-oxopiperidin-1-yl)phenyl]methyl]carbamimidoyl]piperidine-3-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 110993084 |
| Molecular Formula | C22H33IN4O3 |
| Molecular Weight | 528.44 g/mol |
| Exact Mass | 528.16 |
| IUPAC Name | ethyl 1-[N'-methyl-N-[[4-(2-oxopiperidin-1-yl)phenyl]methyl]carbamimidoyl]piperidine-3-carboxylate;hydroiodide |
| SMILES | CCOC(=O)C1CCCN(/C(=N/C)NCc2ccc(N3CCCCC3=O)cc2)C1.I |
| InChI | InChI=1S/C22H32N4O3.HI/c1-3-29-21(28)18-7-6-13-25(16-18)22(23-2)24-15-17-9-11-19(12-10-17)26-14-5-4-8-20(26)27;/h9-12,18H,3-8,13-16H2,1-2H3,(H,23,24);1H |
| InChIKey | UBXMYWPWALLDOB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.44 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|