C18H14FN3OS — CID 71899679
N-(2,3-dihydropyrrolizin-1-ylideneamino)-5-(4-fluorophenyl)thiophene-2-carboxamide (PubChem CID 71899679) has the molecular formula C18H14FN3OS and a molecular weight of 339.40 g/mol. Its IUPAC name is N-(2,3-dihydropyrrolizin-1-ylideneamino)-5-(4-fluorophenyl)thiophene-2-carboxamide.
| Compound Name | N-(2,3-dihydropyrrolizin-1-ylideneamino)-5-(4-fluorophenyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 71899679 |
| Molecular Formula | C18H14FN3OS |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | N-(2,3-dihydropyrrolizin-1-ylideneamino)-5-(4-fluorophenyl)thiophene-2-carboxamide |
| SMILES | O=C(NN=C1CCn2cccc21)c1ccc(-c2ccc(F)cc2)s1 |
| InChI | InChI=1S/C18H14FN3OS/c19-13-5-3-12(4-6-13)16-7-8-17(24-16)18(23)21-20-14-9-11-22-10-1-2-15(14)22/h1-8,10H,9,11H2,(H,21,23) |
| InChIKey | ZFWHIIKUFYGDFJ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_pyrrol(64)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|