C21H26N2OS — CID 164637032
(5-phenylthiophen-2-yl)-[(3R)-3-(piperidin-1-ylmethyl)pyrrolidin-1-yl]methanone (PubChem CID 164637032) has the molecular formula C21H26N2OS and a molecular weight of 354.52 g/mol. Its IUPAC name is (5-phenylthiophen-2-yl)-[(3R)-3-(piperidin-1-ylmethyl)pyrrolidin-1-yl]methanone.
| Compound Name | (5-phenylthiophen-2-yl)-[(3R)-3-(piperidin-1-ylmethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 164637032 |
| Molecular Formula | C21H26N2OS |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | (5-phenylthiophen-2-yl)-[(3R)-3-(piperidin-1-ylmethyl)pyrrolidin-1-yl]methanone |
| SMILES | O=C(c1ccc(-c2ccccc2)s1)N1CC[C@H](CN2CCCCC2)C1 |
| InChI | InChI=1S/C21H26N2OS/c24-21(20-10-9-19(25-20)18-7-3-1-4-8-18)23-14-11-17(16-23)15-22-12-5-2-6-13-22/h1,3-4,7-10,17H,2,5-6,11-16H2/t17-/m1/s1 |
| InChIKey | OMDSGUZLVSAFAF-QGZVFWFLSA-N |
| XLogP | 4.36 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |