C20H28N2O — CID 71929478
(1-phenylcyclopropyl)-[3-(piperidin-1-ylmethyl)pyrrolidin-1-yl]methanone (PubChem CID 71929478) has the molecular formula C20H28N2O and a molecular weight of 312.46 g/mol. Its IUPAC name is (1-phenylcyclopropyl)-[3-(piperidin-1-ylmethyl)pyrrolidin-1-yl]methanone.
| Compound Name | (1-phenylcyclopropyl)-[3-(piperidin-1-ylmethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 71929478 |
| Molecular Formula | C20H28N2O |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | (1-phenylcyclopropyl)-[3-(piperidin-1-ylmethyl)pyrrolidin-1-yl]methanone |
| SMILES | O=C(N1CCC(CN2CCCCC2)C1)C1(c2ccccc2)CC1 |
| InChI | InChI=1S/C20H28N2O/c23-19(20(10-11-20)18-7-3-1-4-8-18)22-14-9-17(16-22)15-21-12-5-2-6-13-21/h1,3-4,7-8,17H,2,5-6,9-16H2 |
| InChIKey | NWEWOCUILABQFM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |